N-Acetyldopamine
Подписчиков: 0, рейтинг: 0
|
| |
| Identifiers | |
|---|---|
|
3D model (JSmol)
|
|
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
|
PubChem CID
|
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C10H13NO3 | |
| Molar mass | 195.218 g·mol−1 |
| Appearance | colorless solid |
| Hazards | |
| GHS labelling: | |
|
|
|
| Warning | |
| H315, H319, H335 | |
| P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
N-Acetyldopamine is the organic compound with the formula CH3C(O)NHCH2CH2C6H3(OH)2. It is the N-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to redox and crosslinking.