Roseophilin

Roseophilin

Names
IUPAC name 15-[5-(3-Chloro-1H-pyrrol-2-yl)-3-methoxy-furan-2-yl]-13-isopropyl-2-aza-tricyclo[10.2.1.13,14]hexadeca-1(15),2-triene
Identifiers
CAS Number	142386-38-7 N
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL1945189 N
ChemSpider	4578301 Y
PubChem CID	5467324
CompTox Dashboard (EPA)	DTXSID20745446
InChI InChI=1S/C27H33ClN2O2/c1-16(2)23-18-11-9-7-5-4-6-8-10-17-14-19(23)25(30-17)24(18)27-22(31-3)15-21(32-27)26-20(28)12-13-29-26/h12-16,18,23,30H,4-11H2,1-3H3/b26-21-,27-24- Y Key: XEQIXGXEBJYNMG-OLPWBVPVSA-N Y InChI=1/C27H33ClN2O2/c1-16(2)23-18-11-9-7-5-4-6-8-10-17-14-19(23)25(30-17)24(18)27-22(31-3)15-21(32-27)26-20(28)12-13-29-26/h12-16,18,23,30H,4-11H2,1-3H3/b26-21-,27-24- Key: XEQIXGXEBJYNMG-OLPWBVPVBQ
SMILES CC(C)[C@H]1[C@@H]\2CCCCCCCCC3=CC1=C(/C2=C\4/C(=C/C(=C/5\C(=CC=N5)Cl)/O4)OC)N3
Properties
Chemical formula	C27H33ClN2O2
Molar mass	453.02 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references

Roseophilin is an antibiotic isolated from Streptomyces griscovirides shown to have antitumor activity. The chemical structure can be considered in terms of two components, a macrotricyclic segment and a heterocyclic side-chain. Several laboratory syntheses of roseophilin (e.g., those of Trost, Fürstner, Salamone) are based upon the Paal-Knorr synthesis, and two others are based on the Nazarov cyclization reaction (those of Tius, Frontier). The compound is related to the prodiginines.