TAN-1057 A

TAN-1057 (A, B)

TAN-1057 A
TAN-1057 B
Identifiers
CAS Number	128126-44-3 (TAN-1057 A) N 128126-45-4 (TAN-1057 B) N
3D model (JSmol)	Interactive image
ChemSpider	110872 Y
PubChem CID	124498
UNII	74EKN36H9V Y
CompTox Dashboard (EPA)	DTXSID20926076
InChI InChI=1S/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8+/m0/s1 Y Key: ZMWBCGMRXBPXEU-JGVFFNPUSA-N Y InChI=1/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8+/m0/s1 Key: ZMWBCGMRXBPXEU-JGVFFNPUBF
SMILES O=C1N\C(=N/C[C@H]1N(C(=O)C[C@@H](N)CCC/N=C(\N)N)C)NC(=O)N
Properties
Chemical formula	C13H25N9O3
Molar mass	355.403 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references

TAN-1057 A and TAN-1057 B are organic compounds found in the Flexibacter sp. PK-74 bacterium. TAN-1057 A and B are closely related structurally as diastereomers. Also related are TAN-1057 C and TAN-1057 D, isolated from the same bacteria. The four compounds have been shown to be an effective antibiotics against methicillin-resistant strains of Staphylococcus aureus which act through the inhibition of protein biosynthesis.